C29H22ClNO3 — CID 66523103
1-[(3-chlorophenyl)methyl]-3-hydroxy-3-[2-oxo-2-(4-phenylphenyl)ethyl]indol-2-one (PubChem CID 66523103) has the molecular formula C29H22ClNO3 and a molecular weight of 467.95 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-hydroxy-3-[2-oxo-2-(4-phenylphenyl)ethyl]indol-2-one.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-hydroxy-3-[2-oxo-2-(4-phenylphenyl)ethyl]indol-2-one |
|---|---|
| PubChem CID | 66523103 |
| Molecular Formula | C29H22ClNO3 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-hydroxy-3-[2-oxo-2-(4-phenylphenyl)ethyl]indol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(Cc2cccc(Cl)c2)c2ccccc21)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H22ClNO3/c30-24-10-6-7-20(17-24)19-31-26-12-5-4-11-25(26)29(34,28(31)33)18-27(32)23-15-13-22(14-16-23)21-8-2-1-3-9-21/h1-17,34H,18-19H2 |
| InChIKey | ZCAPWBQORORWHH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |