C23H17F2NO3 — CID 3442140
1-[(3-fluorophenyl)methyl]-3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxyindol-2-one (PubChem CID 3442140) has the molecular formula C23H17F2NO3 and a molecular weight of 393.39 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxyindol-2-one.
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 3442140 |
| Molecular Formula | C23H17F2NO3 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-[2-(4-fluorophenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(Cc2cccc(F)c2)c2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H17F2NO3/c24-17-10-8-16(9-11-17)21(27)13-23(29)19-6-1-2-7-20(19)26(22(23)28)14-15-4-3-5-18(25)12-15/h1-12,29H,13-14H2 |
| InChIKey | RCJPZTGOLODVTG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |