C23H18FNO3 — CID 3708418
1-[(3-fluorophenyl)methyl]-3-hydroxy-3-phenacylindol-2-one (PubChem CID 3708418) has the molecular formula C23H18FNO3 and a molecular weight of 375.40 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-hydroxy-3-phenacylindol-2-one.
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-hydroxy-3-phenacylindol-2-one |
|---|---|
| PubChem CID | 3708418 |
| Molecular Formula | C23H18FNO3 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-hydroxy-3-phenacylindol-2-one |
| SMILES | O=C(CC1(O)C(=O)N(Cc2cccc(F)c2)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C23H18FNO3/c24-18-10-6-7-16(13-18)15-25-20-12-5-4-11-19(20)23(28,22(25)27)14-21(26)17-8-2-1-3-9-17/h1-13,28H,14-15H2 |
| InChIKey | IPEBFXWUCPWVQN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |