C23H17BrFNO3 — CID 1425877
(3S)-3-[2-(3-bromophenyl)-2-oxoethyl]-1-[(4-fluorophenyl)methyl]-3-hydroxyindol-2-one (PubChem CID 1425877) has the molecular formula C23H17BrFNO3 and a molecular weight of 454.30 g/mol. Its IUPAC name is (3S)-3-[2-(3-bromophenyl)-2-oxoethyl]-1-[(4-fluorophenyl)methyl]-3-hydroxyindol-2-one.
| Compound Name | (3S)-3-[2-(3-bromophenyl)-2-oxoethyl]-1-[(4-fluorophenyl)methyl]-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 1425877 |
| Molecular Formula | C23H17BrFNO3 |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | (3S)-3-[2-(3-bromophenyl)-2-oxoethyl]-1-[(4-fluorophenyl)methyl]-3-hydroxyindol-2-one |
| SMILES | O=C(C[C@@]1(O)C(=O)N(Cc2ccc(F)cc2)c2ccccc21)c1cccc(Br)c1 |
| InChI | InChI=1S/C23H17BrFNO3/c24-17-5-3-4-16(12-17)21(27)13-23(29)19-6-1-2-7-20(19)26(22(23)28)14-15-8-10-18(25)11-9-15/h1-12,29H,13-14H2/t23-/m0/s1 |
| InChIKey | GMIDIWTXDDYDAV-QHCPKHFHSA-N |
| XLogP | 4.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |