C25H22ClNO3 — CID 95244675
(3R)-1-[(3-chlorophenyl)methyl]-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one (PubChem CID 95244675) has the molecular formula C25H22ClNO3 and a molecular weight of 419.91 g/mol. Its IUPAC name is (3R)-1-[(3-chlorophenyl)methyl]-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one.
| Compound Name | (3R)-1-[(3-chlorophenyl)methyl]-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 95244675 |
| Molecular Formula | C25H22ClNO3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (3R)-1-[(3-chlorophenyl)methyl]-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
| SMILES | CCc1ccc(C(=O)C[C@]2(O)C(=O)N(Cc3cccc(Cl)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H22ClNO3/c1-2-17-10-12-19(13-11-17)23(28)15-25(30)21-8-3-4-9-22(21)27(24(25)29)16-18-6-5-7-20(26)14-18/h3-14,30H,2,15-16H2,1H3/t25-/m1/s1 |
| InChIKey | SXWITUZHGGUSNO-RUZDIDTESA-N |
| XLogP | 4.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |