C27H27NO3 — CID 175205314
1-benzyl-3-[2-(4-butylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one (PubChem CID 175205314) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-benzyl-3-[2-(4-butylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one.
| Compound Name | 1-benzyl-3-[2-(4-butylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 175205314 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-benzyl-3-[2-(4-butylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
| SMILES | CCCCc1ccc(C(=O)CC2(O)C(=O)N(Cc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H27NO3/c1-2-3-9-20-14-16-22(17-15-20)25(29)18-27(31)23-12-7-8-13-24(23)28(26(27)30)19-21-10-5-4-6-11-21/h4-8,10-17,31H,2-3,9,18-19H2,1H3 |
| InChIKey | HIWXXUSYYOBMFE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |