C25H21Cl2NO3 — CID 2925747
5-chloro-1-[(4-chlorophenyl)methyl]-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one (PubChem CID 2925747) has the molecular formula C25H21Cl2NO3 and a molecular weight of 454.35 g/mol. Its IUPAC name is 5-chloro-1-[(4-chlorophenyl)methyl]-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one.
| Compound Name | 5-chloro-1-[(4-chlorophenyl)methyl]-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 2925747 |
| Molecular Formula | C25H21Cl2NO3 |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 5-chloro-1-[(4-chlorophenyl)methyl]-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
| SMILES | CCc1ccc(C(=O)CC2(O)C(=O)N(Cc3ccc(Cl)cc3)c3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C25H21Cl2NO3/c1-2-16-3-7-18(8-4-16)23(29)14-25(31)21-13-20(27)11-12-22(21)28(24(25)30)15-17-5-9-19(26)10-6-17/h3-13,31H,2,14-15H2,1H3 |
| InChIKey | QTHWOBDBHVNVEQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |