C24H19ClINO3 — CID 92853040
(3S)-5-chloro-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]-1-[(4-methylphenyl)methyl]indol-2-one (PubChem CID 92853040) has the molecular formula C24H19ClINO3 and a molecular weight of 531.78 g/mol. Its IUPAC name is (3S)-5-chloro-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]-1-[(4-methylphenyl)methyl]indol-2-one.
| Compound Name | (3S)-5-chloro-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]-1-[(4-methylphenyl)methyl]indol-2-one |
|---|---|
| PubChem CID | 92853040 |
| Molecular Formula | C24H19ClINO3 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | (3S)-5-chloro-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]-1-[(4-methylphenyl)methyl]indol-2-one |
| SMILES | Cc1ccc(CN2C(=O)[C@](O)(CC(=O)c3ccc(I)cc3)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C24H19ClINO3/c1-15-2-4-16(5-3-15)14-27-21-11-8-18(25)12-20(21)24(30,23(27)29)13-22(28)17-6-9-19(26)10-7-17/h2-12,30H,13-14H2,1H3/t24-/m0/s1 |
| InChIKey | WRLYTPFJWLXNMI-DEOSSOPVSA-N |
| XLogP | 5.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|