C25H22ClNO4 — CID 3306555
1-benzyl-5-chloro-3-[2-(4-ethoxyphenyl)-2-oxoethyl]-3-hydroxyindol-2-one (PubChem CID 3306555) has the molecular formula C25H22ClNO4 and a molecular weight of 435.91 g/mol. Its IUPAC name is 1-benzyl-5-chloro-3-[2-(4-ethoxyphenyl)-2-oxoethyl]-3-hydroxyindol-2-one.
| Compound Name | 1-benzyl-5-chloro-3-[2-(4-ethoxyphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 3306555 |
| Molecular Formula | C25H22ClNO4 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 1-benzyl-5-chloro-3-[2-(4-ethoxyphenyl)-2-oxoethyl]-3-hydroxyindol-2-one |
| SMILES | CCOc1ccc(C(=O)CC2(O)C(=O)N(Cc3ccccc3)c3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C25H22ClNO4/c1-2-31-20-11-8-18(9-12-20)23(28)15-25(30)21-14-19(26)10-13-22(21)27(24(25)29)16-17-6-4-3-5-7-17/h3-14,30H,2,15-16H2,1H3 |
| InChIKey | LRVVHBFXRGXUJR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |