C28H29N3O2S — CID 102531314
N-[(3S)-1-benzyl-3-(1-methylindol-3-yl)-2-oxoindol-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 102531314) has the molecular formula C28H29N3O2S and a molecular weight of 471.63 g/mol. Its IUPAC name is N-[(3S)-1-benzyl-3-(1-methylindol-3-yl)-2-oxoindol-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(3S)-1-benzyl-3-(1-methylindol-3-yl)-2-oxoindol-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 102531314 |
| Molecular Formula | C28H29N3O2S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-[(3S)-1-benzyl-3-(1-methylindol-3-yl)-2-oxoindol-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | Cn1cc([C@@]2(NS(=O)C(C)(C)C)C(=O)N(Cc3ccccc3)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C28H29N3O2S/c1-27(2,3)34(33)29-28(23-19-30(4)24-16-10-8-14-21(23)24)22-15-9-11-17-25(22)31(26(28)32)18-20-12-6-5-7-13-20/h5-17,19,29H,18H2,1-4H3/t28-,34?/m1/s1 |
| InChIKey | LKOGZZKSHFFHEA-JSAORFSISA-N |
| XLogP | 5.02 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |