C32H25BrClN3O3 — CID 122229525
(3R)-1-benzyl-6-bromo-3-[(1S)-1-(2-chlorophenyl)-2-nitroethyl]-3-(1-methylindol-3-yl)indol-2-one (PubChem CID 122229525) has the molecular formula C32H25BrClN3O3 and a molecular weight of 614.93 g/mol. Its IUPAC name is (3R)-1-benzyl-6-bromo-3-[(1S)-1-(2-chlorophenyl)-2-nitroethyl]-3-(1-methylindol-3-yl)indol-2-one.
| Compound Name | (3R)-1-benzyl-6-bromo-3-[(1S)-1-(2-chlorophenyl)-2-nitroethyl]-3-(1-methylindol-3-yl)indol-2-one |
|---|---|
| PubChem CID | 122229525 |
| Molecular Formula | C32H25BrClN3O3 |
| Molecular Weight | 614.93 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | (3R)-1-benzyl-6-bromo-3-[(1S)-1-(2-chlorophenyl)-2-nitroethyl]-3-(1-methylindol-3-yl)indol-2-one |
| SMILES | Cn1cc([C@@]2([C@H](C[N+](=O)[O-])c3ccccc3Cl)C(=O)N(Cc3ccccc3)c3cc(Br)ccc32)c2ccccc21 |
| InChI | InChI=1S/C32H25BrClN3O3/c1-35-19-26(24-12-6-8-14-29(24)35)32(27(20-37(39)40)23-11-5-7-13-28(23)34)25-16-15-22(33)17-30(25)36(31(32)38)18-21-9-3-2-4-10-21/h2-17,19,27H,18,20H2,1H3/t27-,32+/m1/s1 |
| InChIKey | IBYDEVAKSQVPRJ-ZUKKLESISA-N |
| XLogP | 7.49 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.93 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|