C18H19NO3 — CID 9177438
(3S)-1-benzyl-3-hydroxy-3-[(2R)-2-hydroxypropyl]indol-2-one (PubChem CID 9177438) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (3S)-1-benzyl-3-hydroxy-3-[(2R)-2-hydroxypropyl]indol-2-one.
| Compound Name | (3S)-1-benzyl-3-hydroxy-3-[(2R)-2-hydroxypropyl]indol-2-one |
|---|---|
| PubChem CID | 9177438 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (3S)-1-benzyl-3-hydroxy-3-[(2R)-2-hydroxypropyl]indol-2-one |
| SMILES | C[C@@H](O)C[C@@]1(O)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H19NO3/c1-13(20)11-18(22)15-9-5-6-10-16(15)19(17(18)21)12-14-7-3-2-4-8-14/h2-10,13,20,22H,11-12H2,1H3/t13-,18+/m1/s1 |
| InChIKey | KKWYOWRZWRYLDK-ACJLOTCBSA-N |
| XLogP | 2.19 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |