C17H17NS — CID 848846
1-benzyl-3,3-dimethylindole-2-thione (PubChem CID 848846) has the molecular formula C17H17NS and a molecular weight of 267.40 g/mol. Its IUPAC name is 1-benzyl-3,3-dimethylindole-2-thione.
| Compound Name | 1-benzyl-3,3-dimethylindole-2-thione |
|---|---|
| PubChem CID | 848846 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-benzyl-3,3-dimethylindole-2-thione |
| SMILES | CC1(C)C(=S)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C17H17NS/c1-17(2)14-10-6-7-11-15(14)18(16(17)19)12-13-8-4-3-5-9-13/h3-11H,12H2,1-2H3 |
| InChIKey | GMAGNFAYMDDLNB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|