C19H17NO3 — CID 132554346
(3R,4'R)-1-benzyl-4'-methylspiro[indole-3,5'-oxolane]-2,2'-dione (PubChem CID 132554346) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (3R,4'R)-1-benzyl-4'-methylspiro[indole-3,5'-oxolane]-2,2'-dione.
| Compound Name | (3R,4'R)-1-benzyl-4'-methylspiro[indole-3,5'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 132554346 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3R,4'R)-1-benzyl-4'-methylspiro[indole-3,5'-oxolane]-2,2'-dione |
| SMILES | C[C@@H]1CC(=O)O[C@]12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C19H17NO3/c1-13-11-17(21)23-19(13)15-9-5-6-10-16(15)20(18(19)22)12-14-7-3-2-4-8-14/h2-10,13H,11-12H2,1H3/t13-,19-/m1/s1 |
| InChIKey | LZHHYSDOEBTBAR-BFUOFWGJSA-N |
| XLogP | 3.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |