C22H23NO4 — CID 655041
1-benzyl-3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxyindol-2-one (PubChem CID 655041) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-benzyl-3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxyindol-2-one.
| Compound Name | 1-benzyl-3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 655041 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-benzyl-3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxyindol-2-one |
| SMILES | CC1(C)CC(=O)C(C2(O)C(=O)N(Cc3ccccc3)c3ccccc32)CO1 |
| InChI | InChI=1S/C22H23NO4/c1-21(2)12-19(24)17(14-27-21)22(26)16-10-6-7-11-18(16)23(20(22)25)13-15-8-4-3-5-9-15/h3-11,17,26H,12-14H2,1-2H3 |
| InChIKey | RRQAIKSSQURGAN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |