C37H32N2O4 — CID 10918811
CID 10918811 (PubChem CID 10918811) has the molecular formula C37H32N2O4 and a molecular weight of 568.67 g/mol.
| Compound Name | CID 10918811 |
|---|---|
| PubChem CID | 10918811 |
| Molecular Formula | C37H32N2O4 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | — |
| SMILES | CC1(C)OC2=C[C@@]3(C(=O)N(Cc4ccccc4)c4ccccc43)[C@@]3(C[C@@H]2O1)C(=O)N(Cc1ccccc1)c1ccccc13 |
| InChI | InChI=1S/C37H32N2O4/c1-35(2)42-31-21-36(27-17-9-11-19-29(27)38(33(36)40)23-25-13-5-3-6-14-25)37(22-32(31)43-35)28-18-10-12-20-30(28)39(34(37)41)24-26-15-7-4-8-16-26/h3-21,32H,22-24H2,1-2H3/t32-,36+,37+/m0/s1 |
| InChIKey | OTVNLYAGLKCKQF-PCMUHZCQSA-N |
| XLogP | 6.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |