C22H17N3O — CID 102045340
(2R)-1'-benzyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1-dicarbonitrile (PubChem CID 102045340) has the molecular formula C22H17N3O and a molecular weight of 339.40 g/mol. Its IUPAC name is (2R)-1'-benzyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1-dicarbonitrile.
| Compound Name | (2R)-1'-benzyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 102045340 |
| Molecular Formula | C22H17N3O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | (2R)-1'-benzyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)CCC=C[C@]12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C22H17N3O/c23-15-21(16-24)12-6-7-13-22(21)18-10-4-5-11-19(18)25(20(22)26)14-17-8-2-1-3-9-17/h1-5,7-11,13H,6,12,14H2/t22-/m0/s1 |
| InChIKey | GPQJTNLQRCJHMS-QFIPXVFZSA-N |
| XLogP | 3.85 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|