C34H24N4O2 — CID 132544016
CID 132544016 (PubChem CID 132544016) has the molecular formula C34H24N4O2 and a molecular weight of 520.59 g/mol.
| Compound Name | CID 132544016 |
|---|---|
| PubChem CID | 132544016 |
| Molecular Formula | C34H24N4O2 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)[C@@]1(C(=O)N2Cc2ccccc2)C(C#N)(C#N)[C@@]12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C34H24N4O2/c1-23-16-17-29-27(18-23)34(31(40)38(29)20-25-12-6-3-7-13-25)32(21-35,22-36)33(34)26-14-8-9-15-28(26)37(30(33)39)19-24-10-4-2-5-11-24/h2-18H,19-20H2,1H3/t33-,34-/m1/s1 |
| InChIKey | QRGKKLNAPBQKLN-KKLWWLSJSA-N |
| XLogP | 5.31 |
| TPSA | 88.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |