C31H22ClN5O4S — CID 138963138
CID 138963138 (PubChem CID 138963138) has the molecular formula C31H22ClN5O4S and a molecular weight of 596.07 g/mol.
| Compound Name | CID 138963138 |
|---|---|
| PubChem CID | 138963138 |
| Molecular Formula | C31H22ClN5O4S |
| Molecular Weight | 596.07 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | — |
| SMILES | CCOC(=O)CN1C(=O)[C@@]2(c3cc(Cl)ccc31)C(C#N)(C#N)C(=S)N[C@]21C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H22ClN5O4S/c1-2-41-25(38)16-37-24-13-12-20(32)14-22(24)30(27(37)39)29(17-33,18-34)26(42)35-31(30)21-10-6-7-11-23(21)36(28(31)40)15-19-8-4-3-5-9-19/h3-14H,2,15-16H2,1H3,(H,35,42)/t30-,31+/m0/s1 |
| InChIKey | GEMHWMXCNKMXDJ-IOWSJCHKSA-N |
| XLogP | 3.89 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.07 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|