About CID 102201268
CID 102201268 (PubChem CID 102201268) has the molecular formula C28H22FN3O4S
and a molecular weight of 515.57 g/mol.
Molecular Properties
| Compound Name | CID 102201268 |
| PubChem CID | 102201268 |
| Molecular Formula | C28H22FN3O4S |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1C2(NC(=S)C13C(=O)Nc1c(F)cccc13)C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C28H22FN3O4S/c1-2-36-23(33)22-27(18-12-8-13-19(29)21(18)30-24(27)34)25(37)31-28(22)17-11-6-7-14-20(17)32(26(28)35)15-16-9-4-3-5-10-16/h3-14,22H,2,15H2,1H3,(H,30,34)(H,31,37) |
| InChIKey | SVIUTDFBMNNASM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 102201268 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102201268?
The IUPAC name of CID 102201268 (CID 102201268) is not available.
What is the SMILES notation for CID 102201268?
The canonical SMILES for CID 102201268 is CCOC(=O)C1C2(NC(=S)C13C(=O)Nc1c(F)cccc13)C(=O)N(Cc1ccccc1)c1ccccc12.
What is the InChIKey of CID 102201268?
The InChIKey is SVIUTDFBMNNASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22FN3O4S/c1-2-36-23(33)22-27(18-12-8-13-19(29)21(18)30-24(27)34)25(37)31-28(22)17-11-6-7-14-20(17)32(26(28)35)15-16-9-4-3-5-10-16/h3-14,22H,2,15H2,1H3,(H,30,34)(H,31,37).
What are the key properties of CID 102201268?
CID 102201268 has a molecular weight of 515.57 g/mol, XLogP of 3.57, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102201268 is sourced from PubChem (CID 102201268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).