C41H38FNO9 — CID 132584805
1-O,1-O'-dibenzyl 2-O-ethyl (2S,3R,4R)-1'-benzyl-7'-fluoro-4-(2-methoxy-2-oxoethyl)-2'-oxospiro[cyclopentane-3,3'-indole]-1,1,2-tricarboxylate (PubChem CID 132584805) has the molecular formula C41H38FNO9 and a molecular weight of 707.75 g/mol. Its IUPAC name is 1-O,1-O'-dibenzyl 2-O-ethyl (2S,3R,4R)-1'-benzyl-7'-fluoro-4-(2-methoxy-2-oxoethyl)-2'-oxospiro[cyclopentane-3,3'-indole]-1,1,2-tricarboxylate.
| Compound Name | 1-O,1-O'-dibenzyl 2-O-ethyl (2S,3R,4R)-1'-benzyl-7'-fluoro-4-(2-methoxy-2-oxoethyl)-2'-oxospiro[cyclopentane-3,3'-indole]-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 132584805 |
| Molecular Formula | C41H38FNO9 |
| Molecular Weight | 707.75 g/mol |
| Exact Mass | 707.25 |
| IUPAC Name | 1-O,1-O'-dibenzyl 2-O-ethyl (2S,3R,4R)-1'-benzyl-7'-fluoro-4-(2-methoxy-2-oxoethyl)-2'-oxospiro[cyclopentane-3,3'-indole]-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(C(=O)OCc2ccccc2)(C(=O)OCc2ccccc2)C[C@H](CC(=O)OC)[C@@]12C(=O)N(Cc1ccccc1)c1c(F)cccc12 |
| InChI | InChI=1S/C41H38FNO9/c1-3-50-36(45)35-40(38(47)51-25-28-16-9-5-10-17-28,39(48)52-26-29-18-11-6-12-19-29)23-30(22-33(44)49-2)41(35)31-20-13-21-32(42)34(31)43(37(41)46)24-27-14-7-4-8-15-27/h4-21,30,35H,3,22-26H2,1-2H3/t30-,35+,41-/m0/s1 |
| InChIKey | RUQKQUIBUSABPM-OEGIOAKWSA-N |
| XLogP | 5.85 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.75 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|