C26H18FN3O3S — CID 132850756
(3S,3aR,6aR)-1'-benzyl-5-(4-fluorophenyl)-1-sulfanylidenespiro[3a,6a-dihydro-2H-pyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 132850756) has the molecular formula C26H18FN3O3S and a molecular weight of 471.51 g/mol. Its IUPAC name is (3S,3aR,6aR)-1'-benzyl-5-(4-fluorophenyl)-1-sulfanylidenespiro[3a,6a-dihydro-2H-pyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (3S,3aR,6aR)-1'-benzyl-5-(4-fluorophenyl)-1-sulfanylidenespiro[3a,6a-dihydro-2H-pyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 132850756 |
| Molecular Formula | C26H18FN3O3S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (3S,3aR,6aR)-1'-benzyl-5-(4-fluorophenyl)-1-sulfanylidenespiro[3a,6a-dihydro-2H-pyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | O=C1[C@@H]2C(=S)N[C@@]3(C(=O)N(Cc4ccccc4)c4ccccc43)[C@@H]2C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H18FN3O3S/c27-16-10-12-17(13-11-16)30-23(31)20-21(24(30)32)26(28-22(20)34)18-8-4-5-9-19(18)29(25(26)33)14-15-6-2-1-3-7-15/h1-13,20-21H,14H2,(H,28,34)/t20-,21-,26+/m0/s1 |
| InChIKey | ISUMOELQDRWVAQ-ISJBWFOZSA-N |
| XLogP | 3.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|