C28H24FN3O4 — CID 6558616
(1R,3R,3aR,6aS)-1'-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 6558616) has the molecular formula C28H24FN3O4 and a molecular weight of 485.52 g/mol. Its IUPAC name is (1R,3R,3aR,6aS)-1'-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (1R,3R,3aR,6aS)-1'-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 6558616 |
| Molecular Formula | C28H24FN3O4 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | (1R,3R,3aR,6aS)-1'-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@@H](C2=O)[C@]2(N[C@@H]3C)C(=O)N(Cc3ccc(F)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H24FN3O4/c1-16-23-24(26(34)32(25(23)33)19-11-13-20(36-2)14-12-19)28(30-16)21-5-3-4-6-22(21)31(27(28)35)15-17-7-9-18(29)10-8-17/h3-14,16,23-24,30H,15H2,1-2H3/t16-,23-,24+,28+/m1/s1 |
| InChIKey | VUQHWNUXYMFITN-ALKLHORSSA-N |
| XLogP | 3.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|