C27H28N4O6 — CID 124801482
(1S,3S,3aR,6aS)-5-(4-methoxyphenyl)-1-methyl-1'-(2-morpholin-4-yl-2-oxoethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 124801482) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is (1S,3S,3aR,6aS)-5-(4-methoxyphenyl)-1-methyl-1'-(2-morpholin-4-yl-2-oxoethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (1S,3S,3aR,6aS)-5-(4-methoxyphenyl)-1-methyl-1'-(2-morpholin-4-yl-2-oxoethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 124801482 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (1S,3S,3aR,6aS)-5-(4-methoxyphenyl)-1-methyl-1'-(2-morpholin-4-yl-2-oxoethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@H](C)N[C@@]4(C(=O)N(CC(=O)N5CCOCC5)c5ccccc54)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H28N4O6/c1-16-22-23(25(34)31(24(22)33)17-7-9-18(36-2)10-8-17)27(28-16)19-5-3-4-6-20(19)30(26(27)35)15-21(32)29-11-13-37-14-12-29/h3-10,16,22-23,28H,11-15H2,1-2H3/t16-,22+,23-,27+/m0/s1 |
| InChIKey | JTDJJSRSQXJBQW-RLYVMWQUSA-N |
| XLogP | 0.89 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|