C34H28N4O4 — CID 98066710
(1S,3R,3aR,6aS)-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-methyl-5-naphthalen-1-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 98066710) has the molecular formula C34H28N4O4 and a molecular weight of 556.62 g/mol. Its IUPAC name is (1S,3R,3aR,6aS)-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-methyl-5-naphthalen-1-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (1S,3R,3aR,6aS)-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-methyl-5-naphthalen-1-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 98066710 |
| Molecular Formula | C34H28N4O4 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | (1S,3R,3aR,6aS)-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-methyl-5-naphthalen-1-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | C[C@@H]1N[C@]2(C(=O)N(CC(=O)N3CCc4ccccc43)c3ccccc32)[C@@H]2C(=O)N(c3cccc4ccccc34)C(=O)[C@H]12 |
| InChI | InChI=1S/C34H28N4O4/c1-20-29-30(32(41)38(31(29)40)26-16-8-11-21-9-2-4-12-23(21)26)34(35-20)24-13-5-7-15-27(24)37(33(34)42)19-28(39)36-18-17-22-10-3-6-14-25(22)36/h2-16,20,29-30,35H,17-19H2,1H3/t20-,29+,30-,34-/m0/s1 |
| InChIKey | WIUYFMVPBXWLAG-WTRDRNLISA-N |
| XLogP | 3.77 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|