C31H28N4O4 — CID 124835718
(1S,3R,3aS,6aR)-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-ethyl-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 124835718) has the molecular formula C31H28N4O4 and a molecular weight of 520.59 g/mol. Its IUPAC name is (1S,3R,3aS,6aR)-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-ethyl-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (1S,3R,3aS,6aR)-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-ethyl-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 124835718 |
| Molecular Formula | C31H28N4O4 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | (1S,3R,3aS,6aR)-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-ethyl-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | CC[C@@H]1N[C@]2(C(=O)N(CC(=O)N3CCc4ccccc43)c3ccccc32)[C@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C31H28N4O4/c1-2-22-26-27(29(38)35(28(26)37)20-11-4-3-5-12-20)31(32-22)21-13-7-9-15-24(21)34(30(31)39)18-25(36)33-17-16-19-10-6-8-14-23(19)33/h3-15,22,26-27,32H,2,16-18H2,1H3/t22-,26-,27+,31-/m0/s1 |
| InChIKey | GDCCEAZLXYOVIS-YPAMBENBSA-N |
| XLogP | 3.01 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|