C28H30N4O5S — CID 124783850
(1S,3R,3aS,6aR)-1-(2-methylsulfanylethyl)-1'-(2-morpholin-4-yl-2-oxoethyl)-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 124783850) has the molecular formula C28H30N4O5S and a molecular weight of 534.64 g/mol. Its IUPAC name is (1S,3R,3aS,6aR)-1-(2-methylsulfanylethyl)-1'-(2-morpholin-4-yl-2-oxoethyl)-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (1S,3R,3aS,6aR)-1-(2-methylsulfanylethyl)-1'-(2-morpholin-4-yl-2-oxoethyl)-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 124783850 |
| Molecular Formula | C28H30N4O5S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | (1S,3R,3aS,6aR)-1-(2-methylsulfanylethyl)-1'-(2-morpholin-4-yl-2-oxoethyl)-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | CSCC[C@@H]1N[C@]2(C(=O)N(CC(=O)N3CCOCC3)c3ccccc32)[C@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C28H30N4O5S/c1-38-16-11-20-23-24(26(35)32(25(23)34)18-7-3-2-4-8-18)28(29-20)19-9-5-6-10-21(19)31(27(28)36)17-22(33)30-12-14-37-15-13-30/h2-10,20,23-24,29H,11-17H2,1H3/t20-,23-,24+,28-/m0/s1 |
| InChIKey | VAQRAIRRIIFXAS-MSCFRCFQSA-N |
| XLogP | 1.62 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|