C26H27N3O3S — CID 42554498
(1S,3R,3aR,6aS)-1'-(2-methylprop-2-enyl)-1-(2-methylsulfanylethyl)-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 42554498) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is (1S,3R,3aR,6aS)-1'-(2-methylprop-2-enyl)-1-(2-methylsulfanylethyl)-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (1S,3R,3aR,6aS)-1'-(2-methylprop-2-enyl)-1-(2-methylsulfanylethyl)-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 42554498 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (1S,3R,3aR,6aS)-1'-(2-methylprop-2-enyl)-1-(2-methylsulfanylethyl)-5-phenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | C=C(C)CN1C(=O)[C@]2(N[C@@H](CCSC)[C@H]3C(=O)N(c4ccccc4)C(=O)[C@H]32)c2ccccc21 |
| InChI | InChI=1S/C26H27N3O3S/c1-16(2)15-28-20-12-8-7-11-18(20)26(25(28)32)22-21(19(27-26)13-14-33-3)23(30)29(24(22)31)17-9-5-4-6-10-17/h4-12,19,21-22,27H,1,13-15H2,2-3H3/t19-,21+,22-,26-/m0/s1 |
| InChIKey | GTAAQHYWQCKRKT-IYCJUYGXSA-N |
| XLogP | 3.34 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|