C25H26N4O4S — CID 124767250
N-[4-[(1S,3R,3aS,6aR)-1'-methyl-1-(2-methylsulfanylethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-5-yl]phenyl]acetamide (PubChem CID 124767250) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is N-[4-[(1S,3R,3aS,6aR)-1'-methyl-1-(2-methylsulfanylethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-5-yl]phenyl]acetamide.
| Compound Name | N-[4-[(1S,3R,3aS,6aR)-1'-methyl-1-(2-methylsulfanylethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 124767250 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-[4-[(1S,3R,3aS,6aR)-1'-methyl-1-(2-methylsulfanylethyl)-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-5-yl]phenyl]acetamide |
| SMILES | CSCC[C@@H]1N[C@]2(C(=O)N(C)c3ccccc32)[C@H]2C(=O)N(c3ccc(NC(C)=O)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C25H26N4O4S/c1-14(30)26-15-8-10-16(11-9-15)29-22(31)20-18(12-13-34-3)27-25(21(20)23(29)32)17-6-4-5-7-19(17)28(2)24(25)33/h4-11,18,20-21,27H,12-13H2,1-3H3,(H,26,30)/t18-,20-,21+,25-/m0/s1 |
| InChIKey | DEFJFUFALZXFTQ-MGPQRACWSA-N |
| XLogP | 2.35 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|