C30H28FN3O4S — CID 11947454
(1R,3S,3aR,6aS)-1'-[(2-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 11947454) has the molecular formula C30H28FN3O4S and a molecular weight of 545.64 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-1'-[(2-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aS)-1'-[(2-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 11947454 |
| Molecular Formula | C30H28FN3O4S |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | (1R,3S,3aR,6aS)-1'-[(2-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@@H](C2=O)[C@@]2(N[C@@H]3CCSC)C(=O)N(Cc3ccccc3F)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H28FN3O4S/c1-38-20-13-11-19(12-14-20)34-27(35)25-23(15-16-39-2)32-30(26(25)28(34)36)21-8-4-6-10-24(21)33(29(30)37)17-18-7-3-5-9-22(18)31/h3-14,23,25-26,32H,15-17H2,1-2H3/t23-,25-,26+,30-/m1/s1 |
| InChIKey | QXDXCFYVNWKEGW-YKEGNUIGSA-N |
| XLogP | 4.11 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|