C34H31N3O3S — CID 124783759
(1S,3R,3aS,6aR)-5-benzyl-1-(2-methylsulfanylethyl)-1'-(naphthalen-1-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 124783759) has the molecular formula C34H31N3O3S and a molecular weight of 561.71 g/mol. Its IUPAC name is (1S,3R,3aS,6aR)-5-benzyl-1-(2-methylsulfanylethyl)-1'-(naphthalen-1-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (1S,3R,3aS,6aR)-5-benzyl-1-(2-methylsulfanylethyl)-1'-(naphthalen-1-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 124783759 |
| Molecular Formula | C34H31N3O3S |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | (1S,3R,3aS,6aR)-5-benzyl-1-(2-methylsulfanylethyl)-1'-(naphthalen-1-ylmethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | CSCC[C@@H]1N[C@]2(C(=O)N(Cc3cccc4ccccc34)c3ccccc32)[C@H]2C(=O)N(Cc3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C34H31N3O3S/c1-41-19-18-27-29-30(32(39)37(31(29)38)20-22-10-3-2-4-11-22)34(35-27)26-16-7-8-17-28(26)36(33(34)40)21-24-14-9-13-23-12-5-6-15-25(23)24/h2-17,27,29-30,35H,18-21H2,1H3/t27-,29-,30+,34-/m0/s1 |
| InChIKey | SZPXDUXKOUOUOC-FOPHHFTASA-N |
| XLogP | 5.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|