C37H32N4O4 — CID 98067068
(1S,3R,3aR,6aS)-1,5-dibenzyl-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 98067068) has the molecular formula C37H32N4O4 and a molecular weight of 596.69 g/mol. Its IUPAC name is (1S,3R,3aR,6aS)-1,5-dibenzyl-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (1S,3R,3aR,6aS)-1,5-dibenzyl-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 98067068 |
| Molecular Formula | C37H32N4O4 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | (1S,3R,3aR,6aS)-1,5-dibenzyl-1'-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | O=C1[C@@H]2[C@H](Cc3ccccc3)N[C@]3(C(=O)N(CC(=O)N4CCc5ccccc54)c4ccccc43)[C@@H]2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C37H32N4O4/c42-31(39-20-19-26-15-7-9-17-29(26)39)23-40-30-18-10-8-16-27(30)37(36(40)45)33-32(28(38-37)21-24-11-3-1-4-12-24)34(43)41(35(33)44)22-25-13-5-2-6-14-25/h1-18,28,32-33,38H,19-23H2/t28-,32+,33-,37-/m0/s1 |
| InChIKey | YGUJCLINQPHMLA-ILQCLMRVSA-N |
| XLogP | 3.83 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|