C24H21N3O4 — CID 7320518
(1R,3R,3aR,6aR)-5-(2-methoxyphenyl)-1-methyl-1'-prop-2-ynylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 7320518) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is (1R,3R,3aR,6aR)-5-(2-methoxyphenyl)-1-methyl-1'-prop-2-ynylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (1R,3R,3aR,6aR)-5-(2-methoxyphenyl)-1-methyl-1'-prop-2-ynylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 7320518 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (1R,3R,3aR,6aR)-5-(2-methoxyphenyl)-1-methyl-1'-prop-2-ynylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | C#CCN1C(=O)[C@]2(N[C@H](C)[C@@H]3C(=O)N(c4ccccc4OC)C(=O)[C@H]32)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O4/c1-4-13-26-16-10-6-5-9-15(16)24(23(26)30)20-19(14(2)25-24)21(28)27(22(20)29)17-11-7-8-12-18(17)31-3/h1,5-12,14,19-20,25H,13H2,2-3H3/t14-,19+,20+,24+/m1/s1 |
| InChIKey | KYKKMVPIPARHBG-AJQRVKNESA-N |
| XLogP | 1.67 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|