C28H21FN4O4 — CID 132505467
(7R)-1'-benzyl-4-(4-fluorophenyl)spiro[4,8,9-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-2',3,5,10-tetrone (PubChem CID 132505467) has the molecular formula C28H21FN4O4 and a molecular weight of 496.50 g/mol. Its IUPAC name is (7R)-1'-benzyl-4-(4-fluorophenyl)spiro[4,8,9-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-2',3,5,10-tetrone.
| Compound Name | (7R)-1'-benzyl-4-(4-fluorophenyl)spiro[4,8,9-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-2',3,5,10-tetrone |
|---|---|
| PubChem CID | 132505467 |
| Molecular Formula | C28H21FN4O4 |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | (7R)-1'-benzyl-4-(4-fluorophenyl)spiro[4,8,9-triazatricyclo[6.3.0.02,6]undecane-7,3'-indole]-2',3,5,10-tetrone |
| SMILES | O=C1CC2C3C(=O)N(c4ccc(F)cc4)C(=O)C3[C@@]3(C(=O)N(Cc4ccccc4)c4ccccc43)N2N1 |
| InChI | InChI=1S/C28H21FN4O4/c29-17-10-12-18(13-11-17)32-25(35)23-21-14-22(34)30-33(21)28(24(23)26(32)36)19-8-4-5-9-20(19)31(27(28)37)15-16-6-2-1-3-7-16/h1-13,21,23-24H,14-15H2,(H,30,34)/t21?,23?,24?,28-/m0/s1 |
| InChIKey | BEPSYLHQWOIKID-WBTWJIFMSA-N |
| XLogP | 2.49 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|