C34H30N2O7 — CID 102219896
3-O-ethyl 1-O,2-O-dimethyl (3R,4R)-1'-benzyl-2'-oxospiro[3,4a-dihydrobenzo[f]quinolizine-4,3'-indole]-1,2,3-tricarboxylate (PubChem CID 102219896) has the molecular formula C34H30N2O7 and a molecular weight of 578.62 g/mol. Its IUPAC name is 3-O-ethyl 1-O,2-O-dimethyl (3R,4R)-1'-benzyl-2'-oxospiro[3,4a-dihydrobenzo[f]quinolizine-4,3'-indole]-1,2,3-tricarboxylate.
| Compound Name | 3-O-ethyl 1-O,2-O-dimethyl (3R,4R)-1'-benzyl-2'-oxospiro[3,4a-dihydrobenzo[f]quinolizine-4,3'-indole]-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 102219896 |
| Molecular Formula | C34H30N2O7 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 3-O-ethyl 1-O,2-O-dimethyl (3R,4R)-1'-benzyl-2'-oxospiro[3,4a-dihydrobenzo[f]quinolizine-4,3'-indole]-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1C(C(=O)OC)=C(C(=O)OC)N2c3ccccc3C=CC2[C@@]12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C34H30N2O7/c1-4-43-31(38)28-27(30(37)41-2)29(32(39)42-3)36-24-16-10-8-14-22(24)18-19-26(36)34(28)23-15-9-11-17-25(23)35(33(34)40)20-21-12-6-5-7-13-21/h5-19,26,28H,4,20H2,1-3H3/t26?,28-,34-/m1/s1 |
| InChIKey | YZRQCHQTYGTDAM-HLMCVAQASA-N |
| XLogP | 4.17 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|