C49H38ClN3O8 — CID 102530605
CID 102530605 (PubChem CID 102530605) has the molecular formula C49H38ClN3O8 and a molecular weight of 832.31 g/mol.
| Compound Name | CID 102530605 |
|---|---|
| PubChem CID | 102530605 |
| Molecular Formula | C49H38ClN3O8 |
| Molecular Weight | 832.31 g/mol |
| Exact Mass | 831.23 |
| IUPAC Name | — |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(O[C@H]3[C@@H]4C=C[C@H](N13)[C@]1(C(=O)N(Cc3ccccc3)c3ccccc31)[C@H]4C(=O)c1ccc(Cl)cc1)C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C49H38ClN3O8/c1-59-44(55)40-41(45(56)60-2)53-38-26-25-33(43(53)61-49(40)35-18-10-12-20-37(35)52(47(49)58)28-30-15-7-4-8-16-30)39(42(54)31-21-23-32(50)24-22-31)48(38)34-17-9-11-19-36(34)51(46(48)57)27-29-13-5-3-6-14-29/h3-26,33,38-39,43H,27-28H2,1-2H3/t33-,38+,39-,43+,48+,49-/m1/s1 |
| InChIKey | DSBWZFYVONUZAL-NFKDQCAMSA-N |
| XLogP | 6.89 |
| TPSA | 122.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.31 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|