C37H36N2O9 — CID 102337382
tetramethyl 1-benzyl-1'-(4-tert-butylphenyl)-2-oxospiro[indole-3,6'-pyridine]-2',3',4',5'-tetracarboxylate (PubChem CID 102337382) has the molecular formula C37H36N2O9 and a molecular weight of 652.70 g/mol. Its IUPAC name is tetramethyl 1-benzyl-1'-(4-tert-butylphenyl)-2-oxospiro[indole-3,6'-pyridine]-2',3',4',5'-tetracarboxylate.
| Compound Name | tetramethyl 1-benzyl-1'-(4-tert-butylphenyl)-2-oxospiro[indole-3,6'-pyridine]-2',3',4',5'-tetracarboxylate |
|---|---|
| PubChem CID | 102337382 |
| Molecular Formula | C37H36N2O9 |
| Molecular Weight | 652.70 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | tetramethyl 1-benzyl-1'-(4-tert-butylphenyl)-2-oxospiro[indole-3,6'-pyridine]-2',3',4',5'-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C(C)(C)C)cc2)C2(C(=O)N(Cc3ccccc3)c3ccccc32)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C37H36N2O9/c1-36(2,3)23-17-19-24(20-18-23)39-30(34(43)48-7)28(32(41)46-5)27(31(40)45-4)29(33(42)47-6)37(39)25-15-11-12-16-26(25)38(35(37)44)21-22-13-9-8-10-14-22/h8-20H,21H2,1-7H3 |
| InChIKey | ZYJJZUUHFHRIMW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.70 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|