C29H30N2O4 — CID 11305928
tert-butyl N-[2-[(3S)-1-benzyl-3-[(E)-2-methoxyethenyl]-2-oxoindol-3-yl]phenyl]carbamate (PubChem CID 11305928) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is tert-butyl N-[2-[(3S)-1-benzyl-3-[(E)-2-methoxyethenyl]-2-oxoindol-3-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3S)-1-benzyl-3-[(E)-2-methoxyethenyl]-2-oxoindol-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 11305928 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | tert-butyl N-[2-[(3S)-1-benzyl-3-[(E)-2-methoxyethenyl]-2-oxoindol-3-yl]phenyl]carbamate |
| SMILES | CO/C=C/[C@@]1(c2ccccc2NC(=O)OC(C)(C)C)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H30N2O4/c1-28(2,3)35-27(33)30-24-16-10-8-14-22(24)29(18-19-34-4)23-15-9-11-17-25(23)31(26(29)32)20-21-12-6-5-7-13-21/h5-19H,20H2,1-4H3,(H,30,33)/b19-18+/t29-/m0/s1 |
| InChIKey | JABYKNTVYRQAPX-GDJKVERNSA-N |
| XLogP | 6.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|