C25H27N3O5 — CID 130441992
tert-butyl N-[2-(1-benzyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate (PubChem CID 130441992) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is tert-butyl N-[2-(1-benzyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate.
| Compound Name | tert-butyl N-[2-(1-benzyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate |
|---|---|
| PubChem CID | 130441992 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | tert-butyl N-[2-(1-benzyl-2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc2c1CN(C1CCC(=O)N(Cc3ccccc3)C1=O)C2=O |
| InChI | InChI=1S/C25H27N3O5/c1-25(2,3)33-24(32)26-19-11-7-10-17-18(19)15-27(22(17)30)20-12-13-21(29)28(23(20)31)14-16-8-5-4-6-9-16/h4-11,20H,12-15H2,1-3H3,(H,26,32) |
| InChIKey | NLYHYTMIXSVONA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|