C26H38N4O5 — CID 171827883
tert-butyl 2-[3-[7-(7-aminoheptylamino)-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]acetate (PubChem CID 171827883) has the molecular formula C26H38N4O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is tert-butyl 2-[3-[7-(7-aminoheptylamino)-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-[7-(7-aminoheptylamino)-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 171827883 |
| Molecular Formula | C26H38N4O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | tert-butyl 2-[3-[7-(7-aminoheptylamino)-3-oxo-1H-isoindol-2-yl]-2,6-dioxopiperidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)CCC(N2Cc3c(NCCCCCCCN)cccc3C2=O)C1=O |
| InChI | InChI=1S/C26H38N4O5/c1-26(2,3)35-23(32)17-30-22(31)13-12-21(25(30)34)29-16-19-18(24(29)33)10-9-11-20(19)28-15-8-6-4-5-7-14-27/h9-11,21,28H,4-8,12-17,27H2,1-3H3 |
| InChIKey | XONRXAYIBLLFSE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|