C22H23N3O3 — CID 71658099
tert-butyl N-[(3R)-1-benzyl-3-cyano-5-methyl-2-oxoindol-3-yl]carbamate (PubChem CID 71658099) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-benzyl-3-cyano-5-methyl-2-oxoindol-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-benzyl-3-cyano-5-methyl-2-oxoindol-3-yl]carbamate |
|---|---|
| PubChem CID | 71658099 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | tert-butyl N-[(3R)-1-benzyl-3-cyano-5-methyl-2-oxoindol-3-yl]carbamate |
| SMILES | Cc1ccc2c(c1)[C@](C#N)(NC(=O)OC(C)(C)C)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c1-15-10-11-18-17(12-15)22(14-23,24-20(27)28-21(2,3)4)19(26)25(18)13-16-8-6-5-7-9-16/h5-12H,13H2,1-4H3,(H,24,27)/t22-/m0/s1 |
| InChIKey | IUOBXBCWNTVVHF-QFIPXVFZSA-N |
| XLogP | 3.79 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |