C19H18N2O — CID 102395058
2-(1-benzyl-3,5-dimethyl-2-oxoindol-3-yl)acetonitrile (PubChem CID 102395058) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-(1-benzyl-3,5-dimethyl-2-oxoindol-3-yl)acetonitrile.
| Compound Name | 2-(1-benzyl-3,5-dimethyl-2-oxoindol-3-yl)acetonitrile |
|---|---|
| PubChem CID | 102395058 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-(1-benzyl-3,5-dimethyl-2-oxoindol-3-yl)acetonitrile |
| SMILES | Cc1ccc2c(c1)C(C)(CC#N)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C19H18N2O/c1-14-8-9-17-16(12-14)19(2,10-11-20)18(22)21(17)13-15-6-4-3-5-7-15/h3-9,12H,10,13H2,1-2H3 |
| InChIKey | LKUYUGQVQDFKAC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |