C18H17N5O2 — CID 127035746
1-benzyl-3-hydroxy-5-methyl-3-(2H-tetrazol-5-ylmethyl)indol-2-one (PubChem CID 127035746) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 1-benzyl-3-hydroxy-5-methyl-3-(2H-tetrazol-5-ylmethyl)indol-2-one.
| Compound Name | 1-benzyl-3-hydroxy-5-methyl-3-(2H-tetrazol-5-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 127035746 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-benzyl-3-hydroxy-5-methyl-3-(2H-tetrazol-5-ylmethyl)indol-2-one |
| SMILES | Cc1ccc2c(c1)C(O)(Cc1nn[nH]n1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C18H17N5O2/c1-12-7-8-15-14(9-12)18(25,10-16-19-21-22-20-16)17(24)23(15)11-13-5-3-2-4-6-13/h2-9,25H,10-11H2,1H3,(H,19,20,21,22) |
| InChIKey | YIYLGYQQMWAQHT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |