C20H17NO3 — CID 122213350
(2R)-1'-benzyl-5'-methylspiro[3H-pyran-2,3'-indole]-2',6-dione (PubChem CID 122213350) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is (2R)-1'-benzyl-5'-methylspiro[3H-pyran-2,3'-indole]-2',6-dione.
| Compound Name | (2R)-1'-benzyl-5'-methylspiro[3H-pyran-2,3'-indole]-2',6-dione |
|---|---|
| PubChem CID | 122213350 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (2R)-1'-benzyl-5'-methylspiro[3H-pyran-2,3'-indole]-2',6-dione |
| SMILES | Cc1ccc2c(c1)[C@]1(CC=CC(=O)O1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C20H17NO3/c1-14-9-10-17-16(12-14)20(11-5-8-18(22)24-20)19(23)21(17)13-15-6-3-2-4-7-15/h2-10,12H,11,13H2,1H3/t20-/m1/s1 |
| InChIKey | UZFHWNWVYNWJSE-HXUWFJFHSA-N |
| XLogP | 3.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |