C31H26ClN3O5 — CID 164677791
tert-butyl N-[(3R)-1-benzyl-3-[(6-chloro-3-cyano-2-oxochromen-4-yl)methyl]-2-oxoindol-3-yl]carbamate (PubChem CID 164677791) has the molecular formula C31H26ClN3O5 and a molecular weight of 556.02 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-benzyl-3-[(6-chloro-3-cyano-2-oxochromen-4-yl)methyl]-2-oxoindol-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-benzyl-3-[(6-chloro-3-cyano-2-oxochromen-4-yl)methyl]-2-oxoindol-3-yl]carbamate |
|---|---|
| PubChem CID | 164677791 |
| Molecular Formula | C31H26ClN3O5 |
| Molecular Weight | 556.02 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | tert-butyl N-[(3R)-1-benzyl-3-[(6-chloro-3-cyano-2-oxochromen-4-yl)methyl]-2-oxoindol-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(Cc2c(C#N)c(=O)oc3ccc(Cl)cc23)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H26ClN3O5/c1-30(2,3)40-29(38)34-31(16-22-21-15-20(32)13-14-26(21)39-27(36)23(22)17-33)24-11-7-8-12-25(24)35(28(31)37)18-19-9-5-4-6-10-19/h4-15H,16,18H2,1-3H3,(H,34,38)/t31-/m1/s1 |
| InChIKey | ZYWIVHGRNHKQFQ-WJOKGBTCSA-N |
| XLogP | 5.83 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.02 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|