C32H34ClN3O6 — CID 175130121
tert-butyl N-[(4S)-2-benzyl-4-(3-chlorophenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 175130121) has the molecular formula C32H34ClN3O6 and a molecular weight of 592.09 g/mol. Its IUPAC name is tert-butyl N-[(4S)-2-benzyl-4-(3-chlorophenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[(4S)-2-benzyl-4-(3-chlorophenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 175130121 |
| Molecular Formula | C32H34ClN3O6 |
| Molecular Weight | 592.09 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | tert-butyl N-[(4S)-2-benzyl-4-(3-chlorophenyl)-1,3-dioxoisoquinolin-4-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)[C@]1(c2cccc(Cl)c2)C(=O)N(Cc2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C32H34ClN3O6/c1-30(2,3)41-28(39)34-36(29(40)42-31(4,5)6)32(22-15-12-16-23(33)19-22)25-18-11-10-17-24(25)26(37)35(27(32)38)20-21-13-8-7-9-14-21/h7-19H,20H2,1-6H3,(H,34,39)/t32-/m0/s1 |
| InChIKey | WETQEOOLKSZLGW-YTTGMZPUSA-N |
| XLogP | 6.44 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.09 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|