C21H33N3O4 — CID 139535435
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(4-phenylpiperidin-4-yl)carbamate (PubChem CID 139535435) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(4-phenylpiperidin-4-yl)carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(4-phenylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 139535435 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(4-phenylpiperidin-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)C1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C21H33N3O4/c1-19(2,3)27-17(25)23-24(18(26)28-20(4,5)6)21(12-14-22-15-13-21)16-10-8-7-9-11-16/h7-11,22H,12-15H2,1-6H3,(H,23,25) |
| InChIKey | CFOQPWPVPAGJCH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|