About 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate
4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate (PubChem CID 167316030) has the molecular formula C19H27NO4
and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate |
| PubChem CID | 167316030 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)OC1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C19H27NO4/c1-18(2,3)23-16(21)9-10-17(22)24-19(11-13-20-14-12-19)15-7-5-4-6-8-15/h4-8,20H,9-14H2,1-3H3 |
| InChIKey | ICZQGNUKFPOJHJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate?
The IUPAC name of 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate (CID 167316030) is 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate.
What is the SMILES notation for 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate?
The canonical SMILES for 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate is CC(C)(C)OC(=O)CCC(=O)OC1(c2ccccc2)CCNCC1.
What is the InChIKey of 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate?
The InChIKey is ICZQGNUKFPOJHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO4/c1-18(2,3)23-16(21)9-10-17(22)24-19(11-13-20-14-12-19)15-7-5-4-6-8-15/h4-8,20H,9-14H2,1-3H3.
What are the key properties of 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate?
4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate has a molecular weight of 333.43 g/mol, XLogP of 2.93, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-(4-phenylpiperidin-4-yl) butanedioate is sourced from PubChem (CID 167316030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).