About (4-phenylpiperidin-4-yl) 2-chloroacetate
(4-phenylpiperidin-4-yl) 2-chloroacetate (PubChem CID 167316132) has the molecular formula C13H16ClNO2
and a molecular weight of 253.73 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) 2-chloroacetate.
Molecular Properties
| Compound Name | (4-phenylpiperidin-4-yl) 2-chloroacetate |
| PubChem CID | 167316132 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (4-phenylpiperidin-4-yl) 2-chloroacetate |
| SMILES | O=C(CCl)OC1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C13H16ClNO2/c14-10-12(16)17-13(6-8-15-9-7-13)11-4-2-1-3-5-11/h1-5,15H,6-10H2 |
| InChIKey | VVESHWXBECNBIZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylpiperidin-4-yl) 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylpiperidin-4-yl) 2-chloroacetate?
The IUPAC name of (4-phenylpiperidin-4-yl) 2-chloroacetate (CID 167316132) is (4-phenylpiperidin-4-yl) 2-chloroacetate.
What is the SMILES notation for (4-phenylpiperidin-4-yl) 2-chloroacetate?
The canonical SMILES for (4-phenylpiperidin-4-yl) 2-chloroacetate is O=C(CCl)OC1(c2ccccc2)CCNCC1.
What is the InChIKey of (4-phenylpiperidin-4-yl) 2-chloroacetate?
The InChIKey is VVESHWXBECNBIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO2/c14-10-12(16)17-13(6-8-15-9-7-13)11-4-2-1-3-5-11/h1-5,15H,6-10H2.
What are the key properties of (4-phenylpiperidin-4-yl) 2-chloroacetate?
(4-phenylpiperidin-4-yl) 2-chloroacetate has a molecular weight of 253.73 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylpiperidin-4-yl) 2-chloroacetate is sourced from PubChem (CID 167316132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).