C19H19Cl2NO2S — CID 167316198
(4-phenylpiperidin-4-yl) 2-(2,5-dichlorophenyl)sulfanylacetate (PubChem CID 167316198) has the molecular formula C19H19Cl2NO2S and a molecular weight of 396.34 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) 2-(2,5-dichlorophenyl)sulfanylacetate.
| Compound Name | (4-phenylpiperidin-4-yl) 2-(2,5-dichlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 167316198 |
| Molecular Formula | C19H19Cl2NO2S |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | (4-phenylpiperidin-4-yl) 2-(2,5-dichlorophenyl)sulfanylacetate |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)OC1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C19H19Cl2NO2S/c20-15-6-7-16(21)17(12-15)25-13-18(23)24-19(8-10-22-11-9-19)14-4-2-1-3-5-14/h1-7,12,22H,8-11,13H2 |
| InChIKey | NJWLAUIMRVKMQC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |